About 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid
2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid (PubChem CID 70041250) has the molecular formula C23H42O5
and a molecular weight of 398.58 g/mol. Its IUPAC name is 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid |
| PubChem CID | 70041250 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid |
| SMILES | CCCCCCCC/C=C\CCCCCC(CC(O)CO)C1(C(=O)O)CCO1 |
| InChI | InChI=1S/C23H42O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(18-21(25)19-24)23(22(26)27)16-17-28-23/h9-10,20-21,24-25H,2-8,11-19H2,1H3,(H,26,27)/b10-9- |
| InChIKey | UBINBALRKHCIBB-KTKRTIGZSA-N |
| XLogP | 4.85 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid?
The IUPAC name of 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid (CID 70041250) is 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid.
What is the SMILES notation for 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid?
The canonical SMILES for 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid is CCCCCCCC/C=C\CCCCCC(CC(O)CO)C1(C(=O)O)CCO1.
What is the InChIKey of 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid?
The InChIKey is UBINBALRKHCIBB-KTKRTIGZSA-N. The full InChI is InChI=1S/C23H42O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(18-21(25)19-24)23(22(26)27)16-17-28-23/h9-10,20-21,24-25H,2-8,11-19H2,1H3,(H,26,27)/b10-9-.
What are the key properties of 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid?
2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid has a molecular weight of 398.58 g/mol, XLogP of 4.85, 18 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-1,2-dihydroxynonadec-10-en-4-yl]oxetane-2-carboxylic acid is sourced from PubChem (CID 70041250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).