About 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione
8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione (PubChem CID 70041271) has the molecular formula C18H27N5O2
and a molecular weight of 345.45 g/mol. Its IUPAC name is 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione |
| PubChem CID | 70041271 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione |
| SMILES | CC12N=C(N)N=C1C(=O)N(C1CCCCC1)C(=O)N2C1CCCCC1 |
| InChI | InChI=1S/C18H27N5O2/c1-18-14(20-16(19)21-18)15(24)22(12-8-4-2-5-9-12)17(25)23(18)13-10-6-3-7-11-13/h12-13H,2-11H2,1H3,(H2,19,21) |
| InChIKey | WIUOYOKHENNBEY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione?
The IUPAC name of 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione (CID 70041271) is 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione.
What is the SMILES notation for 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione?
The canonical SMILES for 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione is CC12N=C(N)N=C1C(=O)N(C1CCCCC1)C(=O)N2C1CCCCC1.
What is the InChIKey of 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione?
The InChIKey is WIUOYOKHENNBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5O2/c1-18-14(20-16(19)21-18)15(24)22(12-8-4-2-5-9-12)17(25)23(18)13-10-6-3-7-11-13/h12-13H,2-11H2,1H3,(H2,19,21).
What are the key properties of 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione?
8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione has a molecular weight of 345.45 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-1,3-dicyclohexyl-4-methylpurine-2,6-dione is sourced from PubChem (CID 70041271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).