C26H25F3O9S — CID 70041675
tert-butyl 3-[2-[2-[(1,1-dioxo-1-benzothiophen-2-yl)methoxy]-2-oxoethoxy]ethyl]-4-(2,2,2-trifluoroacetyl)oxybenzoate (PubChem CID 70041675) has the molecular formula C26H25F3O9S and a molecular weight of 570.54 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[(1,1-dioxo-1-benzothiophen-2-yl)methoxy]-2-oxoethoxy]ethyl]-4-(2,2,2-trifluoroacetyl)oxybenzoate.
| Compound Name | tert-butyl 3-[2-[2-[(1,1-dioxo-1-benzothiophen-2-yl)methoxy]-2-oxoethoxy]ethyl]-4-(2,2,2-trifluoroacetyl)oxybenzoate |
|---|---|
| PubChem CID | 70041675 |
| Molecular Formula | C26H25F3O9S |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | tert-butyl 3-[2-[2-[(1,1-dioxo-1-benzothiophen-2-yl)methoxy]-2-oxoethoxy]ethyl]-4-(2,2,2-trifluoroacetyl)oxybenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(OC(=O)C(F)(F)F)c(CCOCC(=O)OCC2=Cc3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C26H25F3O9S/c1-25(2,3)38-23(31)18-8-9-20(37-24(32)26(27,28)29)16(12-18)10-11-35-15-22(30)36-14-19-13-17-6-4-5-7-21(17)39(19,33)34/h4-9,12-13H,10-11,14-15H2,1-3H3 |
| InChIKey | IJGIOCHHALSYSD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|