C39H35N3O3 — CID 70041728
[(10-methyl-4-oxo-2,3-dihydro-1H-pyrido[1,2-a]indol-3-yl)-(2-methyl-1-tritylimidazol-4-yl)methyl] acetate (PubChem CID 70041728) has the molecular formula C39H35N3O3 and a molecular weight of 593.73 g/mol. Its IUPAC name is [(10-methyl-4-oxo-2,3-dihydro-1H-pyrido[1,2-a]indol-3-yl)-(2-methyl-1-tritylimidazol-4-yl)methyl] acetate.
| Compound Name | [(10-methyl-4-oxo-2,3-dihydro-1H-pyrido[1,2-a]indol-3-yl)-(2-methyl-1-tritylimidazol-4-yl)methyl] acetate |
|---|---|
| PubChem CID | 70041728 |
| Molecular Formula | C39H35N3O3 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | [(10-methyl-4-oxo-2,3-dihydro-1H-pyrido[1,2-a]indol-3-yl)-(2-methyl-1-tritylimidazol-4-yl)methyl] acetate |
| SMILES | CC(=O)OC(c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c(C)n1)C1CCc2c(C)c3ccccn3c2C1=O |
| InChI | InChI=1S/C39H35N3O3/c1-26-32-22-23-33(37(44)36(32)41-24-14-13-21-35(26)41)38(45-28(3)43)34-25-42(27(2)40-34)39(29-15-7-4-8-16-29,30-17-9-5-10-18-30)31-19-11-6-12-20-31/h4-21,24-25,33,38H,22-23H2,1-3H3 |
| InChIKey | LDURRTHBXFXNAR-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|