C22H28Br2N2S — CID 70042033
(6aR,10aR)-2,3-dibromo-7-(cyclopropylmethyl)-5-ethyl-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 70042033) has the molecular formula C22H28Br2N2S and a molecular weight of 512.36 g/mol. Its IUPAC name is (6aR,10aR)-2,3-dibromo-7-(cyclopropylmethyl)-5-ethyl-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR,10aR)-2,3-dibromo-7-(cyclopropylmethyl)-5-ethyl-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 70042033 |
| Molecular Formula | C22H28Br2N2S |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | (6aR,10aR)-2,3-dibromo-7-(cyclopropylmethyl)-5-ethyl-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CCc1[nH]c2c(Br)c(Br)cc3c2c1C[C@@H]1[C@@H]3CC(CSC)CN1CC1CC1 |
| InChI | InChI=1S/C22H28Br2N2S/c1-3-18-16-8-19-14(15-7-17(23)21(24)22(25-18)20(15)16)6-13(11-27-2)10-26(19)9-12-4-5-12/h7,12-14,19,25H,3-6,8-11H2,1-2H3/t13?,14-,19-/m1/s1 |
| InChIKey | CKPCSRHKRFOEKJ-SCDSDKBDSA-N |
| XLogP | 6.36 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |