About 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride
6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride (PubChem CID 70042059) has the molecular formula C10H11Cl2NO3
and a molecular weight of 264.11 g/mol. Its IUPAC name is 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride |
| PubChem CID | 70042059 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride |
| SMILES | CN1CCOc2c(C(=O)O)cc(Cl)cc21.Cl |
| InChI | InChI=1S/C10H10ClNO3.ClH/c1-12-2-3-15-9-7(10(13)14)4-6(11)5-8(9)12;/h4-5H,2-3H2,1H3,(H,13,14);1H |
| InChIKey | HQFNQSNMFSHBNG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride?
The IUPAC name of 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride (CID 70042059) is 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride.
What is the SMILES notation for 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride?
The canonical SMILES for 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride is CN1CCOc2c(C(=O)O)cc(Cl)cc21.Cl.
What is the InChIKey of 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride?
The InChIKey is HQFNQSNMFSHBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO3.ClH/c1-12-2-3-15-9-7(10(13)14)4-6(11)5-8(9)12;/h4-5H,2-3H2,1H3,(H,13,14);1H.
What are the key properties of 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride?
6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride has a molecular weight of 264.11 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazine-8-carboxylic acid;hydrochloride is sourced from PubChem (CID 70042059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).