C8H10N2O — CID 70042605
1,2,3,6-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 70042605) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 1,2,3,6-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 70042605 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1,2,3,6-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=C1CCNC2=CC=CCN12 |
| InChI | InChI=1S/C8H10N2O/c11-8-4-5-9-7-3-1-2-6-10(7)8/h1-3,9H,4-6H2 |
| InChIKey | MZPZVIWKKOUNJD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |