C21H23N3O5 — CID 70042617
(Z)-but-2-enedioic acid;1-(1,5-dimethylindol-3-yl)-3-(5-methyl-1H-imidazol-4-yl)propan-1-one (PubChem CID 70042617) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(1,5-dimethylindol-3-yl)-3-(5-methyl-1H-imidazol-4-yl)propan-1-one.
| Compound Name | (Z)-but-2-enedioic acid;1-(1,5-dimethylindol-3-yl)-3-(5-methyl-1H-imidazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 70042617 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(1,5-dimethylindol-3-yl)-3-(5-methyl-1H-imidazol-4-yl)propan-1-one |
| SMILES | Cc1ccc2c(c1)c(C(=O)CCc1nc[nH]c1C)cn2C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H19N3O.C4H4O4/c1-11-4-6-16-13(8-11)14(9-20(16)3)17(21)7-5-15-12(2)18-10-19-15;5-3(6)1-2-4(7)8/h4,6,8-10H,5,7H2,1-3H3,(H,18,19);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | RASSDWCHXMINKU-BTJKTKAUSA-N |
| XLogP | 3.05 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|