About (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole
(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole (PubChem CID 70042653) has the molecular formula C17H23N3O4
and a molecular weight of 333.39 g/mol. Its IUPAC name is (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole.
Molecular Properties
| Compound Name | (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole |
| PubChem CID | 70042653 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)O.c1cn[nH]c1 |
| InChI | InChI=1S/C14H19NO4.C3H4N2/c1-10(2)8-12(13(16)17)15-14(18)19-9-11-6-4-3-5-7-11;1-2-4-5-3-1/h3-7,10,12H,8-9H2,1-2H3,(H,15,18)(H,16,17);1-3H,(H,4,5)/t12-;/m0./s1 |
| InChIKey | SUFCKMSNOFTRPN-YDALLXLXSA-N |
| XLogP | 2.82 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole?
The IUPAC name of (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole (CID 70042653) is (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole.
What is the SMILES notation for (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole?
The canonical SMILES for (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole is CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)O.c1cn[nH]c1.
What is the InChIKey of (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole?
The InChIKey is SUFCKMSNOFTRPN-YDALLXLXSA-N. The full InChI is InChI=1S/C14H19NO4.C3H4N2/c1-10(2)8-12(13(16)17)15-14(18)19-9-11-6-4-3-5-7-11;1-2-4-5-3-1/h3-7,10,12H,8-9H2,1-2H3,(H,15,18)(H,16,17);1-3H,(H,4,5)/t12-;/m0./s1.
What are the key properties of (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole?
(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole has a molecular weight of 333.39 g/mol, XLogP of 2.82, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;1H-pyrazole is sourced from PubChem (CID 70042653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).