C27H29ClFN3O6 — CID 70042713
4-(2-chloro-3-nitrophenyl)-1-[2-[ethyl-[(4-fluorophenyl)methyl]amino]ethyl]-2,4,6-trimethylpyridine-3,5-dicarboxylic acid (PubChem CID 70042713) has the molecular formula C27H29ClFN3O6 and a molecular weight of 546.00 g/mol. Its IUPAC name is 4-(2-chloro-3-nitrophenyl)-1-[2-[ethyl-[(4-fluorophenyl)methyl]amino]ethyl]-2,4,6-trimethylpyridine-3,5-dicarboxylic acid.
| Compound Name | 4-(2-chloro-3-nitrophenyl)-1-[2-[ethyl-[(4-fluorophenyl)methyl]amino]ethyl]-2,4,6-trimethylpyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70042713 |
| Molecular Formula | C27H29ClFN3O6 |
| Molecular Weight | 546.00 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 4-(2-chloro-3-nitrophenyl)-1-[2-[ethyl-[(4-fluorophenyl)methyl]amino]ethyl]-2,4,6-trimethylpyridine-3,5-dicarboxylic acid |
| SMILES | CCN(CCN1C(C)=C(C(=O)O)C(C)(c2cccc([N+](=O)[O-])c2Cl)C(C(=O)O)=C1C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C27H29ClFN3O6/c1-5-30(15-18-9-11-19(29)12-10-18)13-14-31-16(2)22(25(33)34)27(4,23(17(31)3)26(35)36)20-7-6-8-21(24(20)28)32(37)38/h6-12H,5,13-15H2,1-4H3,(H,33,34)(H,35,36) |
| InChIKey | LMTQKWKVKKDRMY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.00 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|