About 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid
2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid (PubChem CID 70042723) has the molecular formula C13H11ClN2O4
and a molecular weight of 294.69 g/mol. Its IUPAC name is 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid.
Molecular Properties
| Compound Name | 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid |
| PubChem CID | 70042723 |
| Molecular Formula | C13H11ClN2O4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid |
| SMILES | CC(=O)C(C(=O)O)=C(CCCl)c1cccc2nonc12 |
| InChI | InChI=1S/C13H11ClN2O4/c1-7(17)11(13(18)19)8(5-6-14)9-3-2-4-10-12(9)16-20-15-10/h2-4H,5-6H2,1H3,(H,18,19) |
| InChIKey | GHMPXNBHSDIDGC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid?
The IUPAC name of 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid (CID 70042723) is 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid.
What is the SMILES notation for 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid?
The canonical SMILES for 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid is CC(=O)C(C(=O)O)=C(CCCl)c1cccc2nonc12.
What is the InChIKey of 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid?
The InChIKey is GHMPXNBHSDIDGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2O4/c1-7(17)11(13(18)19)8(5-6-14)9-3-2-4-10-12(9)16-20-15-10/h2-4H,5-6H2,1H3,(H,18,19).
What are the key properties of 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid?
2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid has a molecular weight of 294.69 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-3-(2,1,3-benzoxadiazol-4-yl)-5-chloropent-2-enoic acid is sourced from PubChem (CID 70042723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).