C14H11N3 — CID 70042728
2-(3,9-Diazatricyclo[8.4.0.01,5]tetradeca-3,5,7,9,11-pentaen-13-ylidene)acetonitrile (PubChem CID 70042728) has the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(3,9-diazatricyclo[8.4.0.01,5]tetradeca-3,5,7,9,11-pentaen-13-ylidene)acetonitrile.
| Compound Name | 2-(3,9-Diazatricyclo[8.4.0.01,5]tetradeca-3,5,7,9,11-pentaen-13-ylidene)acetonitrile |
|---|---|
| PubChem CID | 70042728 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-(3,9-diazatricyclo[8.4.0.01,5]tetradeca-3,5,7,9,11-pentaen-13-ylidene)acetonitrile |
| SMILES | C1C(=CC#N)C=CC2=NC=CC=C3C21CN=C3 |
| InChI | InChI=1S/C14H11N3/c15-6-5-11-3-4-13-14(8-11)10-16-9-12(14)2-1-7-17-13/h1-5,7,9H,8,10H2 |
| InChIKey | NVLXAGLCFRQQAM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 48.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | 590 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|