C21H24F4N2O5 — CID 70043003
5-O-methyl 3-O-propyl 2-(2-aminoethoxymethyl)-6-(fluoromethyl)-4-(2,3,6-trifluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70043003) has the molecular formula C21H24F4N2O5 and a molecular weight of 460.42 g/mol. Its IUPAC name is 5-O-methyl 3-O-propyl 2-(2-aminoethoxymethyl)-6-(fluoromethyl)-4-(2,3,6-trifluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-methyl 3-O-propyl 2-(2-aminoethoxymethyl)-6-(fluoromethyl)-4-(2,3,6-trifluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70043003 |
| Molecular Formula | C21H24F4N2O5 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 5-O-methyl 3-O-propyl 2-(2-aminoethoxymethyl)-6-(fluoromethyl)-4-(2,3,6-trifluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCOC(=O)C1=C(COCCN)NC(CF)=C(C(=O)OC)C1c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C21H24F4N2O5/c1-3-7-32-21(29)17-14(10-31-8-6-26)27-13(9-22)16(20(28)30-2)18(17)15-11(23)4-5-12(24)19(15)25/h4-5,18,27H,3,6-10,26H2,1-2H3 |
| InChIKey | CFVYKKZCJXXGIR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|