About (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol
(1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol (PubChem CID 70043029) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol.
Molecular Properties
| Compound Name | (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol |
| PubChem CID | 70043029 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol |
| SMILES | CCCC[C@@H](O)c1ncnn1C |
| InChI | InChI=1S/C8H15N3O/c1-3-4-5-7(12)8-9-6-10-11(8)2/h6-7,12H,3-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | XNRWSSJLUROXNP-SSDOTTSWSA-N |
| XLogP | 1.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol?
The IUPAC name of (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol (CID 70043029) is (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol.
What is the SMILES notation for (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol?
The canonical SMILES for (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol is CCCC[C@@H](O)c1ncnn1C.
What is the InChIKey of (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol?
The InChIKey is XNRWSSJLUROXNP-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H15N3O/c1-3-4-5-7(12)8-9-6-10-11(8)2/h6-7,12H,3-5H2,1-2H3/t7-/m1/s1.
What are the key properties of (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol?
(1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol has a molecular weight of 169.23 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-1-ol is sourced from PubChem (CID 70043029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).