C28H27NO5 — CID 70043070
benzyl 3-benzyl-4-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-oxobutanoate (PubChem CID 70043070) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is benzyl 3-benzyl-4-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-oxobutanoate.
| Compound Name | benzyl 3-benzyl-4-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 70043070 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | benzyl 3-benzyl-4-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-oxobutanoate |
| SMILES | O=C(CC(Cc1ccccc1)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H27NO5/c30-26(33-19-23-14-8-3-9-15-23)18-24(16-21-10-4-1-5-11-21)27(31)29-25(20-34-28(29)32)17-22-12-6-2-7-13-22/h1-15,24-25H,16-20H2/t24?,25-/m0/s1 |
| InChIKey | PHMPFOFIRNKOSP-BBMPLOMVSA-N |
| XLogP | 4.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |