C39H35N3O2 — CID 70043080
3-[hydroxy-(5-methyl-1-tritylimidazol-4-yl)methyl]-10-prop-2-enyl-2,3-dihydro-1H-pyrido[1,2-a]indol-4-one (PubChem CID 70043080) has the molecular formula C39H35N3O2 and a molecular weight of 577.73 g/mol. Its IUPAC name is 3-[hydroxy-(5-methyl-1-tritylimidazol-4-yl)methyl]-10-prop-2-enyl-2,3-dihydro-1H-pyrido[1,2-a]indol-4-one.
| Compound Name | 3-[hydroxy-(5-methyl-1-tritylimidazol-4-yl)methyl]-10-prop-2-enyl-2,3-dihydro-1H-pyrido[1,2-a]indol-4-one |
|---|---|
| PubChem CID | 70043080 |
| Molecular Formula | C39H35N3O2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 3-[hydroxy-(5-methyl-1-tritylimidazol-4-yl)methyl]-10-prop-2-enyl-2,3-dihydro-1H-pyrido[1,2-a]indol-4-one |
| SMILES | C=CCc1c2c(n3ccccc13)C(=O)C(C(O)c1ncn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c1C)CC2 |
| InChI | InChI=1S/C39H35N3O2/c1-3-15-31-32-23-24-33(38(44)36(32)41-25-14-13-22-34(31)41)37(43)35-27(2)42(26-40-35)39(28-16-7-4-8-17-28,29-18-9-5-10-19-29)30-20-11-6-12-21-30/h3-14,16-22,25-26,33,37,43H,1,15,23-24H2,2H3 |
| InChIKey | RJPAOCATAIXPHU-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|