About 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride
5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride (PubChem CID 70043365) has the molecular formula C8H7ClN2OS2
and a molecular weight of 246.74 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride |
| PubChem CID | 70043365 |
| Molecular Formula | C8H7ClN2OS2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(-c2nccs2)s1 |
| InChI | InChI=1S/C8H6N2OS2.ClH/c9-7(11)5-1-2-6(13-5)8-10-3-4-12-8;/h1-4H,(H2,9,11);1H |
| InChIKey | AOSOWUOXSAPYIA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride?
The IUPAC name of 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride (CID 70043365) is 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride.
What is the SMILES notation for 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride?
The canonical SMILES for 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride is Cl.NC(=O)c1ccc(-c2nccs2)s1.
What is the InChIKey of 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride?
The InChIKey is AOSOWUOXSAPYIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2OS2.ClH/c9-7(11)5-1-2-6(13-5)8-10-3-4-12-8;/h1-4H,(H2,9,11);1H.
What are the key properties of 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride?
5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride has a molecular weight of 246.74 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride is sourced from PubChem (CID 70043365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).