About (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide
(5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide (PubChem CID 70043648) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide.
Molecular Properties
| Compound Name | (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide |
| PubChem CID | 70043648 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide |
| SMILES | C[C@@H]1CC(C(=O)NN(C)C)CN1 |
| InChI | InChI=1S/C8H17N3O/c1-6-4-7(5-9-6)8(12)10-11(2)3/h6-7,9H,4-5H2,1-3H3,(H,10,12)/t6-,7?/m1/s1 |
| InChIKey | VSBAUILPCMUBFX-ULUSZKPHSA-N |
| XLogP | -0.42 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide?
The IUPAC name of (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide (CID 70043648) is (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide.
What is the SMILES notation for (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide?
The canonical SMILES for (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide is C[C@@H]1CC(C(=O)NN(C)C)CN1.
What is the InChIKey of (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide?
The InChIKey is VSBAUILPCMUBFX-ULUSZKPHSA-N. The full InChI is InChI=1S/C8H17N3O/c1-6-4-7(5-9-6)8(12)10-11(2)3/h6-7,9H,4-5H2,1-3H3,(H,10,12)/t6-,7?/m1/s1.
What are the key properties of (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide?
(5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide has a molecular weight of 171.24 g/mol, XLogP of -0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-N',N',5-trimethylpyrrolidine-3-carbohydrazide is sourced from PubChem (CID 70043648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).