About [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate
[(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate (PubChem CID 70043844) has the molecular formula C23H26N2O3
and a molecular weight of 378.47 g/mol. Its IUPAC name is [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate.
Molecular Properties
| Compound Name | [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate |
| PubChem CID | 70043844 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@@H]1CCCC[C@@H]1N(C)c1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-3-27-23(26)28-22-11-7-6-10-21(22)25(2)19-14-12-17(13-15-19)20-9-5-4-8-18(20)16-24/h4-5,8-9,12-15,21-22H,3,6-7,10-11H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | NLNPDLFBWSSEGY-FCHUYYIVSA-N |
| XLogP | 5.15 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate?
The IUPAC name of [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate (CID 70043844) is [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate.
What is the SMILES notation for [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate?
The canonical SMILES for [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate is CCOC(=O)O[C@@H]1CCCC[C@@H]1N(C)c1ccc(-c2ccccc2C#N)cc1.
What is the InChIKey of [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate?
The InChIKey is NLNPDLFBWSSEGY-FCHUYYIVSA-N. The full InChI is InChI=1S/C23H26N2O3/c1-3-27-23(26)28-22-11-7-6-10-21(22)25(2)19-14-12-17(13-15-19)20-9-5-4-8-18(20)16-24/h4-5,8-9,12-15,21-22H,3,6-7,10-11H2,1-2H3/t21-,22+/m0/s1.
What are the key properties of [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate?
[(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate has a molecular weight of 378.47 g/mol, XLogP of 5.15, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-[4-(2-cyanophenyl)-N-methylanilino]cyclohexyl] ethyl carbonate is sourced from PubChem (CID 70043844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).