About (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol
(2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol (PubChem CID 70044384) has the molecular formula C29H41NO4
and a molecular weight of 467.65 g/mol. Its IUPAC name is (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol.
Molecular Properties
| Compound Name | (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol |
| PubChem CID | 70044384 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol |
| SMILES | C[C@@H](O)CCCN1C(C2CCCCC2)COC(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H41NO4/c1-23(31)12-11-19-30-27(26-17-9-4-10-18-26)22-34-29(33-21-25-15-7-3-8-16-25)28(30)32-20-24-13-5-2-6-14-24/h2-3,5-8,13-16,23,26-29,31H,4,9-12,17-22H2,1H3/t23-,27?,28?,29?/m1/s1 |
| InChIKey | SNTZOEYFCOFODX-BYHPCDJZSA-N |
| XLogP | 5.51 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol?
The IUPAC name of (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol (CID 70044384) is (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol.
What is the SMILES notation for (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol?
The canonical SMILES for (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol is C[C@@H](O)CCCN1C(C2CCCCC2)COC(OCc2ccccc2)C1OCc1ccccc1.
What is the InChIKey of (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol?
The InChIKey is SNTZOEYFCOFODX-BYHPCDJZSA-N. The full InChI is InChI=1S/C29H41NO4/c1-23(31)12-11-19-30-27(26-17-9-4-10-18-26)22-34-29(33-21-25-15-7-3-8-16-25)28(30)32-20-24-13-5-2-6-14-24/h2-3,5-8,13-16,23,26-29,31H,4,9-12,17-22H2,1H3/t23-,27?,28?,29?/m1/s1.
What are the key properties of (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol?
(2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol has a molecular weight of 467.65 g/mol, XLogP of 5.51, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-[5-cyclohexyl-2,3-bis(phenylmethoxy)morpholin-4-yl]pentan-2-ol is sourced from PubChem (CID 70044384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).