About [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate
[(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate (PubChem CID 70044488) has the molecular formula C28H34N2O4
and a molecular weight of 462.59 g/mol. Its IUPAC name is [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate.
Molecular Properties
| Compound Name | [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate |
| PubChem CID | 70044488 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2C#N)cc1)[C@H]1CCCC[C@H]1OC(=O)OCC |
| InChI | InChI=1S/C28H34N2O4/c1-3-5-14-27(31)30(25-12-8-9-13-26(25)34-28(32)33-4-2)20-21-15-17-22(18-16-21)24-11-7-6-10-23(24)19-29/h6-7,10-11,15-18,25-26H,3-5,8-9,12-14,20H2,1-2H3/t25-,26+/m0/s1 |
| InChIKey | JJOMWWUBAAZVMU-IZZNHLLZSA-N |
| XLogP | 6.23 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate?
The IUPAC name of [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate (CID 70044488) is [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate.
What is the SMILES notation for [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate?
The canonical SMILES for [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate is CCCCC(=O)N(Cc1ccc(-c2ccccc2C#N)cc1)[C@H]1CCCC[C@H]1OC(=O)OCC.
What is the InChIKey of [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate?
The InChIKey is JJOMWWUBAAZVMU-IZZNHLLZSA-N. The full InChI is InChI=1S/C28H34N2O4/c1-3-5-14-27(31)30(25-12-8-9-13-26(25)34-28(32)33-4-2)20-21-15-17-22(18-16-21)24-11-7-6-10-23(24)19-29/h6-7,10-11,15-18,25-26H,3-5,8-9,12-14,20H2,1-2H3/t25-,26+/m0/s1.
What are the key properties of [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate?
[(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate has a molecular weight of 462.59 g/mol, XLogP of 6.23, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]cyclohexyl] ethyl carbonate is sourced from PubChem (CID 70044488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).