C32H56O6Si — CID 70044506
[(1S,3S,4aS,7S,8S,8aS)-3-acetyl-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 70044506) has the molecular formula C32H56O6Si and a molecular weight of 564.88 g/mol. Its IUPAC name is [(1S,3S,4aS,7S,8S,8aS)-3-acetyl-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3S,4aS,7S,8S,8aS)-3-acetyl-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 70044506 |
| Molecular Formula | C32H56O6Si |
| Molecular Weight | 564.88 g/mol |
| Exact Mass | 564.38 |
| IUPAC Name | [(1S,3S,4aS,7S,8S,8aS)-3-acetyl-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C(C)=O)C[C@@H]2CC[C@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C32H56O6Si/c1-11-32(7,8)30(35)37-27-17-23(21(3)33)16-22-13-12-20(2)26(29(22)27)15-14-24-18-25(19-28(34)36-24)38-39(9,10)31(4,5)6/h20,22-27,29H,11-19H2,1-10H3/t20-,22-,23-,24+,25+,26-,27-,29-/m0/s1 |
| InChIKey | JUIAXYNUKSAJRB-MEILDDLNSA-N |
| XLogP | 7.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.88 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|