C24H23ClN2O5S — CID 70044574
1-[3-(4-chlorophenyl)-2,3-dihydrobenzo[f][1,4]benzothiazin-1-yl]-2-(dimethylamino)ethanone;oxalic acid (PubChem CID 70044574) has the molecular formula C24H23ClN2O5S and a molecular weight of 486.98 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-2,3-dihydrobenzo[f][1,4]benzothiazin-1-yl]-2-(dimethylamino)ethanone;oxalic acid.
| Compound Name | 1-[3-(4-chlorophenyl)-2,3-dihydrobenzo[f][1,4]benzothiazin-1-yl]-2-(dimethylamino)ethanone;oxalic acid |
|---|---|
| PubChem CID | 70044574 |
| Molecular Formula | C24H23ClN2O5S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-2,3-dihydrobenzo[f][1,4]benzothiazin-1-yl]-2-(dimethylamino)ethanone;oxalic acid |
| SMILES | CN(C)CC(=O)N1CC(c2ccc(Cl)cc2)Sc2ccc3ccccc3c21.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H21ClN2OS.C2H2O4/c1-24(2)14-21(26)25-13-20(16-7-10-17(23)11-8-16)27-19-12-9-15-5-3-4-6-18(15)22(19)25;3-1(4)2(5)6/h3-12,20H,13-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | CUDICLAYWVIBIG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|