C28H32ClN3O8 — CID 70044588
2-[3-[[(2S)-7-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxoheptan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid;hydrochloride (PubChem CID 70044588) has the molecular formula C28H32ClN3O8 and a molecular weight of 574.03 g/mol. Its IUPAC name is 2-[3-[[(2S)-7-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxoheptan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid;hydrochloride.
| Compound Name | 2-[3-[[(2S)-7-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxoheptan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 70044588 |
| Molecular Formula | C28H32ClN3O8 |
| Molecular Weight | 574.03 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 2-[3-[[(2S)-7-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxoheptan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid;hydrochloride |
| SMILES | CCOC(=O)[C@H](CCCCCN1C(=O)c2ccccc2C1=O)NC1COc2ccccc2N(CC(=O)O)C1=O.Cl |
| InChI | InChI=1S/C28H31N3O8.ClH/c1-2-38-28(37)20(12-4-3-9-15-30-25(34)18-10-5-6-11-19(18)26(30)35)29-21-17-39-23-14-8-7-13-22(23)31(27(21)36)16-24(32)33;/h5-8,10-11,13-14,20-21,29H,2-4,9,12,15-17H2,1H3,(H,32,33);1H/t20-,21?;/m0./s1 |
| InChIKey | XAYKCQVYUWGFLB-FQQMSVSDSA-N |
| XLogP | 2.66 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.03 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|