C22H21Cl2NO8S — CID 70044681
4-[[2-[(2,6-dichlorobenzoyl)oxymethyl]-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl]oxy]butanoic acid (PubChem CID 70044681) has the molecular formula C22H21Cl2NO8S and a molecular weight of 530.38 g/mol. Its IUPAC name is 4-[[2-[(2,6-dichlorobenzoyl)oxymethyl]-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl]oxy]butanoic acid.
| Compound Name | 4-[[2-[(2,6-dichlorobenzoyl)oxymethyl]-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 70044681 |
| Molecular Formula | C22H21Cl2NO8S |
| Molecular Weight | 530.38 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | 4-[[2-[(2,6-dichlorobenzoyl)oxymethyl]-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl]oxy]butanoic acid |
| SMILES | CC(C)c1cc(OCCCC(=O)O)cc2c1C(=O)N(COC(=O)c1c(Cl)cccc1Cl)S2(=O)=O |
| InChI | InChI=1S/C22H21Cl2NO8S/c1-12(2)14-9-13(32-8-4-7-18(26)27)10-17-19(14)21(28)25(34(17,30)31)11-33-22(29)20-15(23)5-3-6-16(20)24/h3,5-6,9-10,12H,4,7-8,11H2,1-2H3,(H,26,27) |
| InChIKey | KMCFBYSYYLCQMM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|