C24H33N5O3S — CID 70045074
3-N-[4-[4-(1-oxo-1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]bicyclo[2.2.1]heptane-2,3-dicarboxamide (PubChem CID 70045074) has the molecular formula C24H33N5O3S and a molecular weight of 471.63 g/mol. Its IUPAC name is 3-N-[4-[4-(1-oxo-1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]bicyclo[2.2.1]heptane-2,3-dicarboxamide.
| Compound Name | 3-N-[4-[4-(1-oxo-1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]bicyclo[2.2.1]heptane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 70045074 |
| Molecular Formula | C24H33N5O3S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 3-N-[4-[4-(1-oxo-1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]bicyclo[2.2.1]heptane-2,3-dicarboxamide |
| SMILES | NC(=O)C1C2CCC(C2)C1C(=O)NCCCCN1CCN(C2=NS(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C24H33N5O3S/c25-22(30)20-16-7-8-17(15-16)21(20)24(31)26-9-3-4-10-28-11-13-29(14-12-28)23-18-5-1-2-6-19(18)33(32)27-23/h1-2,5-6,16-17,20-21H,3-4,7-15H2,(H2,25,30)(H,26,31) |
| InChIKey | MVFHXYGXXYFMJC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|