About 4H-chromen-4-ol;hydrochloride
4H-chromen-4-ol;hydrochloride (PubChem CID 70045554) has the molecular formula C9H9ClO2
and a molecular weight of 184.62 g/mol. Its IUPAC name is 4H-chromen-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 4H-chromen-4-ol;hydrochloride |
| PubChem CID | 70045554 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 4H-chromen-4-ol;hydrochloride |
| SMILES | Cl.OC1C=COc2ccccc21 |
| InChI | InChI=1S/C9H8O2.ClH/c10-8-5-6-11-9-4-2-1-3-7(8)9;/h1-6,8,10H;1H |
| InChIKey | PPSNPHVWBLDHID-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-chromen-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-chromen-4-ol;hydrochloride?
The IUPAC name of 4H-chromen-4-ol;hydrochloride (CID 70045554) is 4H-chromen-4-ol;hydrochloride.
What is the SMILES notation for 4H-chromen-4-ol;hydrochloride?
The canonical SMILES for 4H-chromen-4-ol;hydrochloride is Cl.OC1C=COc2ccccc21.
What is the InChIKey of 4H-chromen-4-ol;hydrochloride?
The InChIKey is PPSNPHVWBLDHID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.ClH/c10-8-5-6-11-9-4-2-1-3-7(8)9;/h1-6,8,10H;1H.
What are the key properties of 4H-chromen-4-ol;hydrochloride?
4H-chromen-4-ol;hydrochloride has a molecular weight of 184.62 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-chromen-4-ol;hydrochloride is sourced from PubChem (CID 70045554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).