C12H17N3O2S3 — CID 7004560
1-[[(4S)-4-hydroxy-3-methylsulfanyl-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl]amino]-3-methylthiourea (PubChem CID 7004560) has the molecular formula C12H17N3O2S3 and a molecular weight of 331.49 g/mol. Its IUPAC name is 1-[[(4S)-4-hydroxy-3-methylsulfanyl-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl]amino]-3-methylthiourea.
| Compound Name | 1-[[(4S)-4-hydroxy-3-methylsulfanyl-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 7004560 |
| Molecular Formula | C12H17N3O2S3 |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-[[(4S)-4-hydroxy-3-methylsulfanyl-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl]amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)c1sc(SC)c2c1CCC[C@@H]2O |
| InChI | InChI=1S/C12H17N3O2S3/c1-13-12(18)15-14-10(17)9-6-4-3-5-7(16)8(6)11(19-2)20-9/h7,16H,3-5H2,1-2H3,(H,14,17)(H2,13,15,18)/t7-/m0/s1 |
| InChIKey | PZVYBAQHSGHMSG-ZETCQYMHSA-N |
| XLogP | 1.58 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|