C22H33NO5 — CID 7004570
(3S,3aS,4S,4aR,5S,9aR)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 7004570) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is (3S,3aS,4S,4aR,5S,9aR)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,4S,4aR,5S,9aR)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 7004570 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (3S,3aS,4S,4aR,5S,9aR)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@H]1CCC=C2C[C@H]3OC(=O)[C@H](CN4CCC5(CC4)OCCO5)[C@H]3[C@H](O)[C@@]21C |
| InChI | InChI=1S/C22H33NO5/c1-14-4-3-5-15-12-17-18(19(24)21(14,15)2)16(20(25)28-17)13-23-8-6-22(7-9-23)26-10-11-27-22/h5,14,16-19,24H,3-4,6-13H2,1-2H3/t14-,16+,17+,18+,19-,21+/m0/s1 |
| InChIKey | NIQPEHCERNDLQS-AHBSSGKESA-N |
| XLogP | 2.11 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|