C7H7N — CID 70045748
1,2-dihydrocyclopenta[c]pyrrole (PubChem CID 70045748) has the molecular formula C7H7N and a molecular weight of 105.14 g/mol. Its IUPAC name is 1,2-dihydrocyclopenta[c]pyrrole.
| Compound Name | 1,2-dihydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 70045748 |
| Molecular Formula | C7H7N |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 1,2-dihydrocyclopenta[c]pyrrole |
| SMILES | C1=CC2=CNCC2=C1 |
| InChI | InChI=1S/C7H7N/c1-2-6-4-8-5-7(6)3-1/h1-4,8H,5H2 |
| InChIKey | USWOSEUQVQFFGW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |