C27H43N3O6 — CID 70045855
benzyl N-[(2S)-1-[(2S)-2-[(1,1-diethoxy-3-methylbutan-2-yl)carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 70045855) has the molecular formula C27H43N3O6 and a molecular weight of 505.66 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2S)-2-[(1,1-diethoxy-3-methylbutan-2-yl)carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2S)-2-[(1,1-diethoxy-3-methylbutan-2-yl)carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70045855 |
| Molecular Formula | C27H43N3O6 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | benzyl N-[(2S)-1-[(2S)-2-[(1,1-diethoxy-3-methylbutan-2-yl)carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCOC(OCC)C(NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(C)C |
| InChI | InChI=1S/C27H43N3O6/c1-7-34-26(35-8-2)23(19(5)6)28-24(31)21-15-12-16-30(21)25(32)22(18(3)4)29-27(33)36-17-20-13-10-9-11-14-20/h9-11,13-14,18-19,21-23,26H,7-8,12,15-17H2,1-6H3,(H,28,31)(H,29,33)/t21-,22-,23?/m0/s1 |
| InChIKey | CPNGSXXIPAIRFE-OJSMNCEXSA-N |
| XLogP | 3.47 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|