C27H39NO3S — CID 70046199
3-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-(4-aminobut-2-ynylsulfanyl)-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one (PubChem CID 70046199) has the molecular formula C27H39NO3S and a molecular weight of 457.68 g/mol. Its IUPAC name is 3-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-(4-aminobut-2-ynylsulfanyl)-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one.
| Compound Name | 3-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-(4-aminobut-2-ynylsulfanyl)-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 70046199 |
| Molecular Formula | C27H39NO3S |
| Molecular Weight | 457.68 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 3-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-(4-aminobut-2-ynylsulfanyl)-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| SMILES | C[C@]12CC[C@H](SCC#CCN)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C3=CC(=O)OC3)CC[C@]12O |
| InChI | InChI=1S/C27H39NO3S/c1-25-10-7-20(32-14-4-3-13-28)16-19(25)5-6-23-22(25)8-11-26(2)21(9-12-27(23,26)30)18-15-24(29)31-17-18/h15,19-23,30H,5-14,16-17,28H2,1-2H3/t19-,20+,21-,22+,23-,25+,26-,27+/m1/s1 |
| InChIKey | AWVMQBSZZVTHBV-JDCBOAFFSA-N |
| XLogP | 4.31 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|