About 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one
2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 70046454) has the molecular formula C10H10ClNO3S
and a molecular weight of 259.71 g/mol. Its IUPAC name is 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 70046454 |
| Molecular Formula | C10H10ClNO3S |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CCc1cccc2c1C(=O)N(CCl)S2(=O)=O |
| InChI | InChI=1S/C10H10ClNO3S/c1-2-7-4-3-5-8-9(7)10(13)12(6-11)16(8,14)15/h3-5H,2,6H2,1H3 |
| InChIKey | SZVHEAIPGDZOAG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one (CID 70046454) is 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one is CCc1cccc2c1C(=O)N(CCl)S2(=O)=O.
What is the InChIKey of 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is SZVHEAIPGDZOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO3S/c1-2-7-4-3-5-8-9(7)10(13)12(6-11)16(8,14)15/h3-5H,2,6H2,1H3.
What are the key properties of 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one?
2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 259.71 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 70046454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).