About 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride
2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride (PubChem CID 70046984) has the molecular formula C14H15ClN4O2
and a molecular weight of 306.75 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride |
| PubChem CID | 70046984 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride |
| SMILES | COc1ccc(-c2nc3ncccn3c2N)c(OC)c1.Cl |
| InChI | InChI=1S/C14H14N4O2.ClH/c1-19-9-4-5-10(11(8-9)20-2)12-13(15)18-7-3-6-16-14(18)17-12;/h3-8H,15H2,1-2H3;1H |
| InChIKey | NWECHUQPYQDTFP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride?
The IUPAC name of 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride (CID 70046984) is 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride.
What is the SMILES notation for 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride?
The canonical SMILES for 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride is COc1ccc(-c2nc3ncccn3c2N)c(OC)c1.Cl.
What is the InChIKey of 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride?
The InChIKey is NWECHUQPYQDTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O2.ClH/c1-19-9-4-5-10(11(8-9)20-2)12-13(15)18-7-3-6-16-14(18)17-12;/h3-8H,15H2,1-2H3;1H.
What are the key properties of 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride?
2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride has a molecular weight of 306.75 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine;hydrochloride is sourced from PubChem (CID 70046984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).