C34H46F3N7O5 — CID 70047027
N-benzyl-2-[(4-carbamimidoylphenyl)methyl]-N'-[(1S)-1-cyclohexyl-2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]propanediamide;2,2,2-trifluoroacetic acid (PubChem CID 70047027) has the molecular formula C34H46F3N7O5 and a molecular weight of 689.78 g/mol. Its IUPAC name is N-benzyl-2-[(4-carbamimidoylphenyl)methyl]-N'-[(1S)-1-cyclohexyl-2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]propanediamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-benzyl-2-[(4-carbamimidoylphenyl)methyl]-N'-[(1S)-1-cyclohexyl-2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]propanediamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70047027 |
| Molecular Formula | C34H46F3N7O5 |
| Molecular Weight | 689.78 g/mol |
| Exact Mass | 689.35 |
| IUPAC Name | N-benzyl-2-[(4-carbamimidoylphenyl)methyl]-N'-[(1S)-1-cyclohexyl-2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]propanediamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CC(C(=O)NCc2ccccc2)C(=O)N[C@H](C(=O)NCCN2CCNCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H45N7O3.C2HF3O2/c33-29(34)26-13-11-23(12-14-26)21-27(30(40)37-22-24-7-3-1-4-8-24)31(41)38-28(25-9-5-2-6-10-25)32(42)36-17-20-39-18-15-35-16-19-39;3-2(4,5)1(6)7/h1,3-4,7-8,11-14,25,27-28,35H,2,5-6,9-10,15-22H2,(H3,33,34)(H,36,42)(H,37,40)(H,38,41);(H,6,7)/t27?,28-;/m0./s1 |
| InChIKey | QTWFKPLDQUENCQ-LJPJKQEESA-N |
| XLogP | 2.17 |
| TPSA | 189.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.78 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|