About 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride
4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride (PubChem CID 70047066) has the molecular formula C8H18ClN3O
and a molecular weight of 207.70 g/mol. Its IUPAC name is 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride |
| PubChem CID | 70047066 |
| Molecular Formula | C8H18ClN3O |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N(C)C)N1CCC(O)CC1 |
| InChI | InChI=1S/C8H17N3O.ClH/c1-10(2)8(9)11-5-3-7(12)4-6-11;/h7,9,12H,3-6H2,1-2H3;1H/b9-8+; |
| InChIKey | UOOODPXIUAKJQB-HRNDJLQDSA-N |
| XLogP | 0.36 |
| TPSA | 50.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride?
The IUPAC name of 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride (CID 70047066) is 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride.
What is the SMILES notation for 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride?
The canonical SMILES for 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride is Cl.[H]/N=C(\N(C)C)N1CCC(O)CC1.
What is the InChIKey of 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride?
The InChIKey is UOOODPXIUAKJQB-HRNDJLQDSA-N. The full InChI is InChI=1S/C8H17N3O.ClH/c1-10(2)8(9)11-5-3-7(12)4-6-11;/h7,9,12H,3-6H2,1-2H3;1H/b9-8+;.
What are the key properties of 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride?
4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride has a molecular weight of 207.70 g/mol, XLogP of 0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride is sourced from PubChem (CID 70047066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).