C30H46O8S — CID 70047916
9-(1,3-dioxolan-2-yl)-2-[[(2R,3R,4S,5R,6R)-3-hydroxy-5-methoxy-6-methyl-4-methylsulfanyloxan-2-yl]oxymethyl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 70047916) has the molecular formula C30H46O8S and a molecular weight of 566.76 g/mol. Its IUPAC name is 9-(1,3-dioxolan-2-yl)-2-[[(2R,3R,4S,5R,6R)-3-hydroxy-5-methoxy-6-methyl-4-methylsulfanyloxan-2-yl]oxymethyl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | 9-(1,3-dioxolan-2-yl)-2-[[(2R,3R,4S,5R,6R)-3-hydroxy-5-methoxy-6-methyl-4-methylsulfanyloxan-2-yl]oxymethyl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 70047916 |
| Molecular Formula | C30H46O8S |
| Molecular Weight | 566.76 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 9-(1,3-dioxolan-2-yl)-2-[[(2R,3R,4S,5R,6R)-3-hydroxy-5-methoxy-6-methyl-4-methylsulfanyloxan-2-yl]oxymethyl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CO[C@H]1[C@@H](SC)[C@H](O)[C@H](OCC23CC4C(C)CCC4C4(C5OCCO5)CC2C=C(C(C)C)C34C(=O)O)O[C@@H]1C |
| InChI | InChI=1S/C30H46O8S/c1-15(2)21-11-18-12-29(27-35-9-10-36-27)20-8-7-16(3)19(20)13-28(18,30(21,29)26(32)33)14-37-25-22(31)24(39-6)23(34-5)17(4)38-25/h11,15-20,22-25,27,31H,7-10,12-14H2,1-6H3,(H,32,33)/t16?,17-,18?,19?,20?,22+,23-,24+,25-,28?,29?,30?/m1/s1 |
| InChIKey | SPOMGYGPALHDAD-UTUKMRDLSA-N |
| XLogP | 3.95 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|