C34H54N4O7 — CID 70048485
[(1S)-1-[[(2R,4S,5S)-6-cyclohexyl-4-hydroxy-5-[[(3S)-oxolan-3-yl]oxycarbonylamino]-2-propan-2-ylhexanoyl]amino]-2,3-dihydroinden-1-yl] (2R)-2,5-diaminopentanoate (PubChem CID 70048485) has the molecular formula C34H54N4O7 and a molecular weight of 630.83 g/mol. Its IUPAC name is [(1S)-1-[[(2R,4S,5S)-6-cyclohexyl-4-hydroxy-5-[[(3S)-oxolan-3-yl]oxycarbonylamino]-2-propan-2-ylhexanoyl]amino]-2,3-dihydroinden-1-yl] (2R)-2,5-diaminopentanoate.
| Compound Name | [(1S)-1-[[(2R,4S,5S)-6-cyclohexyl-4-hydroxy-5-[[(3S)-oxolan-3-yl]oxycarbonylamino]-2-propan-2-ylhexanoyl]amino]-2,3-dihydroinden-1-yl] (2R)-2,5-diaminopentanoate |
|---|---|
| PubChem CID | 70048485 |
| Molecular Formula | C34H54N4O7 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.40 |
| IUPAC Name | [(1S)-1-[[(2R,4S,5S)-6-cyclohexyl-4-hydroxy-5-[[(3S)-oxolan-3-yl]oxycarbonylamino]-2-propan-2-ylhexanoyl]amino]-2,3-dihydroinden-1-yl] (2R)-2,5-diaminopentanoate |
| SMILES | CC(C)[C@@H](C[C@H](O)[C@H](CC1CCCCC1)NC(=O)O[C@H]1CCOC1)C(=O)N[C@]1(OC(=O)[C@H](N)CCCN)CCc2ccccc21 |
| InChI | InChI=1S/C34H54N4O7/c1-22(2)26(20-30(39)29(19-23-9-4-3-5-10-23)37-33(42)44-25-15-18-43-21-25)31(40)38-34(45-32(41)28(36)13-8-17-35)16-14-24-11-6-7-12-27(24)34/h6-7,11-12,22-23,25-26,28-30,39H,3-5,8-10,13-21,35-36H2,1-2H3,(H,37,42)(H,38,40)/t25-,26+,28+,29-,30-,34-/m0/s1 |
| InChIKey | GKPJWHRBESFOFW-GPZQDPABSA-N |
| XLogP | 3.39 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|