C14H26F3NO2 — CID 70049640
5-cyclohexyl-1-[methyl(1,2,2-trifluoroethyl)amino]pentane-2,3-diol (PubChem CID 70049640) has the molecular formula C14H26F3NO2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 5-cyclohexyl-1-[methyl(1,2,2-trifluoroethyl)amino]pentane-2,3-diol.
| Compound Name | 5-cyclohexyl-1-[methyl(1,2,2-trifluoroethyl)amino]pentane-2,3-diol |
|---|---|
| PubChem CID | 70049640 |
| Molecular Formula | C14H26F3NO2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 5-cyclohexyl-1-[methyl(1,2,2-trifluoroethyl)amino]pentane-2,3-diol |
| SMILES | CN(CC(O)C(O)CCC1CCCCC1)C(F)C(F)F |
| InChI | InChI=1S/C14H26F3NO2/c1-18(14(17)13(15)16)9-12(20)11(19)8-7-10-5-3-2-4-6-10/h10-14,19-20H,2-9H2,1H3 |
| InChIKey | FNDPBMXEIZJJCJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|