About methylsulfinylmethane;thiolane 1,1-dioxide
methylsulfinylmethane;thiolane 1,1-dioxide (PubChem CID 70050002) has the molecular formula C6H14O3S2
and a molecular weight of 198.31 g/mol. Its IUPAC name is methylsulfinylmethane;thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | methylsulfinylmethane;thiolane 1,1-dioxide |
| PubChem CID | 70050002 |
| Molecular Formula | C6H14O3S2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | methylsulfinylmethane;thiolane 1,1-dioxide |
| SMILES | CS(C)=O.O=S1(=O)CCCC1 |
| InChI | InChI=1S/C4H8O2S.C2H6OS/c5-7(6)3-1-2-4-7;1-4(2)3/h1-4H2;1-2H3 |
| InChIKey | SZZYAOCSMNDGPI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methylsulfinylmethane;thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfinylmethane;thiolane 1,1-dioxide?
The IUPAC name of methylsulfinylmethane;thiolane 1,1-dioxide (CID 70050002) is methylsulfinylmethane;thiolane 1,1-dioxide.
What is the SMILES notation for methylsulfinylmethane;thiolane 1,1-dioxide?
The canonical SMILES for methylsulfinylmethane;thiolane 1,1-dioxide is CS(C)=O.O=S1(=O)CCCC1.
What is the InChIKey of methylsulfinylmethane;thiolane 1,1-dioxide?
The InChIKey is SZZYAOCSMNDGPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2S.C2H6OS/c5-7(6)3-1-2-4-7;1-4(2)3/h1-4H2;1-2H3.
What are the key properties of methylsulfinylmethane;thiolane 1,1-dioxide?
methylsulfinylmethane;thiolane 1,1-dioxide has a molecular weight of 198.31 g/mol, XLogP of 0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfinylmethane;thiolane 1,1-dioxide is sourced from PubChem (CID 70050002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).