About 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol
8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol (PubChem CID 70050491) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol.
Molecular Properties
| Compound Name | 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol |
| PubChem CID | 70050491 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol |
| SMILES | OC1C=C2CC3CCN2C(C1)C3 |
| InChI | InChI=1S/C10H15NO/c12-10-5-8-3-7-1-2-11(8)9(4-7)6-10/h5,7,9-10,12H,1-4,6H2 |
| InChIKey | XPZXEAMCUNLAJP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol?
The IUPAC name of 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol (CID 70050491) is 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol.
What is the SMILES notation for 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol?
The canonical SMILES for 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol is OC1C=C2CC3CCN2C(C1)C3.
What is the InChIKey of 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol?
The InChIKey is XPZXEAMCUNLAJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c12-10-5-8-3-7-1-2-11(8)9(4-7)6-10/h5,7,9-10,12H,1-4,6H2.
What are the key properties of 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol?
8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol has a molecular weight of 165.24 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azatricyclo[5.3.1.03,8]undec-3-en-5-ol is sourced from PubChem (CID 70050491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).