C34H44Cl3N5O5 — CID 70051032
(1,1,1-trichloro-2-methylpropan-2-yl) 2-[6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-2-[[4-(dimethylamino)benzoyl]amino]-4H-quinazolin-3-yl]acetate (PubChem CID 70051032) has the molecular formula C34H44Cl3N5O5 and a molecular weight of 709.12 g/mol. Its IUPAC name is (1,1,1-trichloro-2-methylpropan-2-yl) 2-[6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-2-[[4-(dimethylamino)benzoyl]amino]-4H-quinazolin-3-yl]acetate.
| Compound Name | (1,1,1-trichloro-2-methylpropan-2-yl) 2-[6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-2-[[4-(dimethylamino)benzoyl]amino]-4H-quinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 70051032 |
| Molecular Formula | C34H44Cl3N5O5 |
| Molecular Weight | 709.12 g/mol |
| Exact Mass | 707.24 |
| IUPAC Name | (1,1,1-trichloro-2-methylpropan-2-yl) 2-[6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-2-[[4-(dimethylamino)benzoyl]amino]-4H-quinazolin-3-yl]acetate |
| SMILES | CN(C)c1ccc(C(=O)NC2=Nc3ccc(OCCCC(=O)N(C)C4CCCCC4)cc3CN2CC(=O)OC(C)(C)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C34H44Cl3N5O5/c1-33(2,34(35,36)37)47-30(44)22-42-21-24-20-27(46-19-9-12-29(43)41(5)26-10-7-6-8-11-26)17-18-28(24)38-32(42)39-31(45)23-13-15-25(16-14-23)40(3)4/h13-18,20,26H,6-12,19,21-22H2,1-5H3,(H,38,39,45) |
| InChIKey | WHPRXBHTYYACOB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.12 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|