C28H35N3O3S — CID 70051052
butyl 2-[1-amino-6-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate (PubChem CID 70051052) has the molecular formula C28H35N3O3S and a molecular weight of 493.67 g/mol. Its IUPAC name is butyl 2-[1-amino-6-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | butyl 2-[1-amino-6-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 70051052 |
| Molecular Formula | C28H35N3O3S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | butyl 2-[1-amino-6-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1CCc2cc(C(=O)c3ccc(C=NN4CCSCC4)cc3)ccc2C1N |
| InChI | InChI=1S/C28H35N3O3S/c1-2-3-14-34-26(32)18-23-9-8-22-17-24(10-11-25(22)27(23)29)28(33)21-6-4-20(5-7-21)19-30-31-12-15-35-16-13-31/h4-7,10-11,17,19,23,27H,2-3,8-9,12-16,18,29H2,1H3 |
| InChIKey | YFAMLPDCRYRGOF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|