About (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene
(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene (PubChem CID 700515) has the molecular formula C13H18N6
and a molecular weight of 258.33 g/mol. Its IUPAC name is (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene.
Molecular Properties
| Compound Name | (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene |
| PubChem CID | 700515 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene |
| SMILES | Cc1cc(C)c2c(N=NN3CCCCC3)[nH]nc2n1 |
| InChI | InChI=1S/C13H18N6/c1-9-8-10(2)14-12-11(9)13(16-15-12)17-18-19-6-4-3-5-7-19/h8H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | JBICABPBRPGFNV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene?
The IUPAC name of (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene (CID 700515) is (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene.
What is the SMILES notation for (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene?
The canonical SMILES for (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene is Cc1cc(C)c2c(N=NN3CCCCC3)[nH]nc2n1.
What is the InChIKey of (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene?
The InChIKey is JBICABPBRPGFNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N6/c1-9-8-10(2)14-12-11(9)13(16-15-12)17-18-19-6-4-3-5-7-19/h8H,3-7H2,1-2H3,(H,14,15,16).
What are the key properties of (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene?
(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene has a molecular weight of 258.33 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)-piperidin-1-yldiazene is sourced from PubChem (CID 700515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).