C26H31N3O3S — CID 70051977
ethyl 2-[1-amino-7-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate (PubChem CID 70051977) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is ethyl 2-[1-amino-7-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[1-amino-7-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 70051977 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | ethyl 2-[1-amino-7-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
| SMILES | CCOC(=O)CC1CCc2ccc(C(=O)c3ccc(C=NN4CCSCC4)cc3)cc2C1N |
| InChI | InChI=1S/C26H31N3O3S/c1-2-32-24(30)16-21-9-7-19-8-10-22(15-23(19)25(21)27)26(31)20-5-3-18(4-6-20)17-28-29-11-13-33-14-12-29/h3-6,8,10,15,17,21,25H,2,7,9,11-14,16,27H2,1H3 |
| InChIKey | XGSZBIXVVUKKRN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|