About 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one
1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one (PubChem CID 70052054) has the molecular formula C8H4F3NO3S
and a molecular weight of 251.19 g/mol. Its IUPAC name is 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one |
| PubChem CID | 70052054 |
| Molecular Formula | C8H4F3NO3S |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one |
| SMILES | O=C1NS(=O)(=O)c2c1cccc2C(F)(F)F |
| InChI | InChI=1S/C8H4F3NO3S/c9-8(10,11)5-3-1-2-4-6(5)16(14,15)12-7(4)13/h1-3H,(H,12,13) |
| InChIKey | ATQAWRXZUBCDTP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one?
The IUPAC name of 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one (CID 70052054) is 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one.
What is the SMILES notation for 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one?
The canonical SMILES for 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one is O=C1NS(=O)(=O)c2c1cccc2C(F)(F)F.
What is the InChIKey of 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one?
The InChIKey is ATQAWRXZUBCDTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3NO3S/c9-8(10,11)5-3-1-2-4-6(5)16(14,15)12-7(4)13/h1-3H,(H,12,13).
What are the key properties of 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one?
1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one has a molecular weight of 251.19 g/mol, XLogP of 1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-7-(trifluoromethyl)-1,2-benzothiazol-3-one is sourced from PubChem (CID 70052054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).