C31H41N3O4 — CID 70052103
heptyl 2-[1-amino-6-[4-(morpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate (PubChem CID 70052103) has the molecular formula C31H41N3O4 and a molecular weight of 519.69 g/mol. Its IUPAC name is heptyl 2-[1-amino-6-[4-(morpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | heptyl 2-[1-amino-6-[4-(morpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 70052103 |
| Molecular Formula | C31H41N3O4 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | heptyl 2-[1-amino-6-[4-(morpholin-4-yliminomethyl)benzoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
| SMILES | CCCCCCCOC(=O)CC1CCc2cc(C(=O)c3ccc(C=NN4CCOCC4)cc3)ccc2C1N |
| InChI | InChI=1S/C31H41N3O4/c1-2-3-4-5-6-17-38-29(35)21-26-12-11-25-20-27(13-14-28(25)30(26)32)31(36)24-9-7-23(8-10-24)22-33-34-15-18-37-19-16-34/h7-10,13-14,20,22,26,30H,2-6,11-12,15-19,21,32H2,1H3 |
| InChIKey | WTWLNWPXSIUPPH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|