C17H20N4S — CID 7005232
6-cyclohexyl-3-(3,5-dimethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 7005232) has the molecular formula C17H20N4S and a molecular weight of 312.44 g/mol. Its IUPAC name is 6-cyclohexyl-3-(3,5-dimethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-cyclohexyl-3-(3,5-dimethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 7005232 |
| Molecular Formula | C17H20N4S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 6-cyclohexyl-3-(3,5-dimethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1cc(C)cc(-c2nnc3sc(C4CCCCC4)nn23)c1 |
| InChI | InChI=1S/C17H20N4S/c1-11-8-12(2)10-14(9-11)15-18-19-17-21(15)20-16(22-17)13-6-4-3-5-7-13/h8-10,13H,3-7H2,1-2H3 |
| InChIKey | PBTAPXAJPRMOMF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |