C26H35FN2 — CID 70053028
2-[[(3R,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 70053028) has the molecular formula C26H35FN2 and a molecular weight of 394.58 g/mol. Its IUPAC name is 2-[[(3R,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[[(3R,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 70053028 |
| Molecular Formula | C26H35FN2 |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | 2-[[(3R,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCCCN1CC[C@H](c2ccc(F)cc2)[C@@H](CN2CCc3ccccc3C2)C1 |
| InChI | InChI=1S/C26H35FN2/c1-2-3-6-15-28-17-14-26(22-9-11-25(27)12-10-22)24(19-28)20-29-16-13-21-7-4-5-8-23(21)18-29/h4-5,7-12,24,26H,2-3,6,13-20H2,1H3/t24-,26-/m1/s1 |
| InChIKey | VYDFHZIAEDAXGL-AOYPEHQESA-N |
| XLogP | 5.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|