C20H24N2O3S — CID 70053089
(3S,5S)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-1,2-benzothiazepin-4-one (PubChem CID 70053089) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is (3S,5S)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-1,2-benzothiazepin-4-one.
| Compound Name | (3S,5S)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-1,2-benzothiazepin-4-one |
|---|---|
| PubChem CID | 70053089 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (3S,5S)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-1,2-benzothiazepin-4-one |
| SMILES | COc1ccc(N2Sc3ccccc3[C@H](CCN(C)C)C(=O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-21(2)13-12-17-16-6-4-5-7-18(16)26-22(20(24)19(17)23)14-8-10-15(25-3)11-9-14/h4-11,17,20,24H,12-13H2,1-3H3/t17-,20-/m0/s1 |
| InChIKey | RQMFRFSNKMNDFU-PXNSSMCTSA-N |
| XLogP | 3.15 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|